C24H25N5O7 — CID 4843053
[2-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)amino]-2-oxoethyl] 4-morpholin-4-yl-3-nitrobenzoate (PubChem CID 4843053) has the molecular formula C24H25N5O7 and a molecular weight of 495.49 g/mol. Its IUPAC name is [2-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)amino]-2-oxoethyl] 4-morpholin-4-yl-3-nitrobenzoate.
| Compound Name | [2-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)amino]-2-oxoethyl] 4-morpholin-4-yl-3-nitrobenzoate |
|---|---|
| PubChem CID | 4843053 |
| Molecular Formula | C24H25N5O7 |
| Molecular Weight | 495.49 g/mol |
| Exact Mass | 495.18 |
| IUPAC Name | [2-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)amino]-2-oxoethyl] 4-morpholin-4-yl-3-nitrobenzoate |
| SMILES | Cc1c(NC(=O)COC(=O)c2ccc(N3CCOCC3)c([N+](=O)[O-])c2)c(=O)n(-c2ccccc2)n1C |
| InChI | InChI=1S/C24H25N5O7/c1-16-22(23(31)28(26(16)2)18-6-4-3-5-7-18)25-21(30)15-36-24(32)17-8-9-19(20(14-17)29(33)34)27-10-12-35-13-11-27/h3-9,14H,10-13,15H2,1-2H3,(H,25,30) |
| InChIKey | UVRDLWJFVFMGHD-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 137.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.49 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|