C27H31N5O6 — CID 5030164
[1-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)amino]-1-oxopropan-2-yl] 4-(3-methylpiperidin-1-yl)-3-nitrobenzoate (PubChem CID 5030164) has the molecular formula C27H31N5O6 and a molecular weight of 521.57 g/mol. Its IUPAC name is [1-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)amino]-1-oxopropan-2-yl] 4-(3-methylpiperidin-1-yl)-3-nitrobenzoate.
| Compound Name | [1-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)amino]-1-oxopropan-2-yl] 4-(3-methylpiperidin-1-yl)-3-nitrobenzoate |
|---|---|
| PubChem CID | 5030164 |
| Molecular Formula | C27H31N5O6 |
| Molecular Weight | 521.57 g/mol |
| Exact Mass | 521.23 |
| IUPAC Name | [1-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)amino]-1-oxopropan-2-yl] 4-(3-methylpiperidin-1-yl)-3-nitrobenzoate |
| SMILES | Cc1c(NC(=O)C(C)OC(=O)c2ccc(N3CCCC(C)C3)c([N+](=O)[O-])c2)c(=O)n(-c2ccccc2)n1C |
| InChI | InChI=1S/C27H31N5O6/c1-17-9-8-14-30(16-17)22-13-12-20(15-23(22)32(36)37)27(35)38-19(3)25(33)28-24-18(2)29(4)31(26(24)34)21-10-6-5-7-11-21/h5-7,10-13,15,17,19H,8-9,14,16H2,1-4H3,(H,28,33) |
| InChIKey | AYEQGFQSWMARQI-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 128.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.57 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|