C25H33N3O3 — CID 18276209
N-[2,6-di(propan-2-yl)phenyl]-4-(3-methylpiperidin-1-yl)-3-nitrobenzamide (PubChem CID 18276209) has the molecular formula C25H33N3O3 and a molecular weight of 423.56 g/mol. Its IUPAC name is N-[2,6-di(propan-2-yl)phenyl]-4-(3-methylpiperidin-1-yl)-3-nitrobenzamide.
| Compound Name | N-[2,6-di(propan-2-yl)phenyl]-4-(3-methylpiperidin-1-yl)-3-nitrobenzamide |
|---|---|
| PubChem CID | 18276209 |
| Molecular Formula | C25H33N3O3 |
| Molecular Weight | 423.56 g/mol |
| Exact Mass | 423.25 |
| IUPAC Name | N-[2,6-di(propan-2-yl)phenyl]-4-(3-methylpiperidin-1-yl)-3-nitrobenzamide |
| SMILES | CC1CCCN(c2ccc(C(=O)Nc3c(C(C)C)cccc3C(C)C)cc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C25H33N3O3/c1-16(2)20-9-6-10-21(17(3)4)24(20)26-25(29)19-11-12-22(23(14-19)28(30)31)27-13-7-8-18(5)15-27/h6,9-12,14,16-18H,7-8,13,15H2,1-5H3,(H,26,29) |
| InChIKey | JKLJSIUDFJCKMM-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.56 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|