C22H27N3O6 — CID 18273584
4-(3-methylpiperidin-1-yl)-3-nitro-N-(3,4,5-trimethoxyphenyl)benzamide (PubChem CID 18273584) has the molecular formula C22H27N3O6 and a molecular weight of 429.47 g/mol. Its IUPAC name is 4-(3-methylpiperidin-1-yl)-3-nitro-N-(3,4,5-trimethoxyphenyl)benzamide.
| Compound Name | 4-(3-methylpiperidin-1-yl)-3-nitro-N-(3,4,5-trimethoxyphenyl)benzamide |
|---|---|
| PubChem CID | 18273584 |
| Molecular Formula | C22H27N3O6 |
| Molecular Weight | 429.47 g/mol |
| Exact Mass | 429.19 |
| IUPAC Name | 4-(3-methylpiperidin-1-yl)-3-nitro-N-(3,4,5-trimethoxyphenyl)benzamide |
| SMILES | COc1cc(NC(=O)c2ccc(N3CCCC(C)C3)c([N+](=O)[O-])c2)cc(OC)c1OC |
| InChI | InChI=1S/C22H27N3O6/c1-14-6-5-9-24(13-14)17-8-7-15(10-18(17)25(27)28)22(26)23-16-11-19(29-2)21(31-4)20(12-16)30-3/h7-8,10-12,14H,5-6,9,13H2,1-4H3,(H,23,26) |
| InChIKey | JZYOQNBQABSWDT-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 103.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.47 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|