C22H26N4O5S — CID 46677915
N-[3-(cyclopropylsulfamoyl)phenyl]-4-(3-methylpiperidin-1-yl)-3-nitrobenzamide (PubChem CID 46677915) has the molecular formula C22H26N4O5S and a molecular weight of 458.54 g/mol. Its IUPAC name is N-[3-(cyclopropylsulfamoyl)phenyl]-4-(3-methylpiperidin-1-yl)-3-nitrobenzamide.
| Compound Name | N-[3-(cyclopropylsulfamoyl)phenyl]-4-(3-methylpiperidin-1-yl)-3-nitrobenzamide |
|---|---|
| PubChem CID | 46677915 |
| Molecular Formula | C22H26N4O5S |
| Molecular Weight | 458.54 g/mol |
| Exact Mass | 458.16 |
| IUPAC Name | N-[3-(cyclopropylsulfamoyl)phenyl]-4-(3-methylpiperidin-1-yl)-3-nitrobenzamide |
| SMILES | CC1CCCN(c2ccc(C(=O)Nc3cccc(S(=O)(=O)NC4CC4)c3)cc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C22H26N4O5S/c1-15-4-3-11-25(14-15)20-10-7-16(12-21(20)26(28)29)22(27)23-18-5-2-6-19(13-18)32(30,31)24-17-8-9-17/h2,5-7,10,12-13,15,17,24H,3-4,8-9,11,14H2,1H3,(H,23,27) |
| InChIKey | JOHVHGPOJLTKMS-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 121.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.54 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|