C30H26N3O3P — CID 3526394
4-[(2-diphenylphosphoryloxyphenyl)methylideneamino]-1,5-dimethyl-2-phenylpyrazol-3-one (PubChem CID 3526394) has the molecular formula C30H26N3O3P and a molecular weight of 507.53 g/mol. Its IUPAC name is 4-[(2-diphenylphosphoryloxyphenyl)methylideneamino]-1,5-dimethyl-2-phenylpyrazol-3-one.
| Compound Name | 4-[(2-diphenylphosphoryloxyphenyl)methylideneamino]-1,5-dimethyl-2-phenylpyrazol-3-one |
|---|---|
| PubChem CID | 3526394 |
| Molecular Formula | C30H26N3O3P |
| Molecular Weight | 507.53 g/mol |
| Exact Mass | 507.17 |
| IUPAC Name | 4-[(2-diphenylphosphoryloxyphenyl)methylideneamino]-1,5-dimethyl-2-phenylpyrazol-3-one |
| SMILES | Cc1c(/N=C/c2ccccc2OP(=O)(c2ccccc2)c2ccccc2)c(=O)n(-c2ccccc2)n1C |
| InChI | InChI=1S/C30H26N3O3P/c1-23-29(30(34)33(32(23)2)25-15-6-3-7-16-25)31-22-24-14-12-13-21-28(24)36-37(35,26-17-8-4-9-18-26)27-19-10-5-11-20-27/h3-22H,1-2H3/b31-22+ |
| InChIKey | XLTSPTKYFFMJBZ-DFKUXCBWSA-N |
| XLogP | 5.54 |
| TPSA | 65.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.53 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|