C29H27N5O2S — CID 6392025
(5E)-5-[[4-(dimethylamino)phenyl]methylidene]-2-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)imino-3-phenyl-1,3-thiazolidin-4-one (PubChem CID 6392025) has the molecular formula C29H27N5O2S and a molecular weight of 509.64 g/mol. Its IUPAC name is (5E)-5-[[4-(dimethylamino)phenyl]methylidene]-2-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)imino-3-phenyl-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[[4-(dimethylamino)phenyl]methylidene]-2-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)imino-3-phenyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 6392025 |
| Molecular Formula | C29H27N5O2S |
| Molecular Weight | 509.64 g/mol |
| Exact Mass | 509.19 |
| IUPAC Name | (5E)-5-[[4-(dimethylamino)phenyl]methylidene]-2-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)imino-3-phenyl-1,3-thiazolidin-4-one |
| SMILES | Cc1c(/N=C2\S/C(=C/c3ccc(N(C)C)cc3)C(=O)N2c2ccccc2)c(=O)n(-c2ccccc2)n1C |
| InChI | InChI=1S/C29H27N5O2S/c1-20-26(28(36)34(32(20)4)24-13-9-6-10-14-24)30-29-33(23-11-7-5-8-12-23)27(35)25(37-29)19-21-15-17-22(18-16-21)31(2)3/h5-19H,1-4H3/b25-19+,30-29- |
| InChIKey | QBPIZOVEZTWWME-YTZMEOJYSA-N |
| XLogP | 5.36 |
| TPSA | 62.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.64 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|