C21H17BrN4O2S — CID 135527183
(5Z)-5-[(4-bromophenyl)methylidene]-2-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)imino-1,3-thiazolidin-4-one (PubChem CID 135527183) has the molecular formula C21H17BrN4O2S and a molecular weight of 469.36 g/mol. Its IUPAC name is (5Z)-5-[(4-bromophenyl)methylidene]-2-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)imino-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[(4-bromophenyl)methylidene]-2-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135527183 |
| Molecular Formula | C21H17BrN4O2S |
| Molecular Weight | 469.36 g/mol |
| Exact Mass | 468.03 |
| IUPAC Name | (5Z)-5-[(4-bromophenyl)methylidene]-2-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)imino-1,3-thiazolidin-4-one |
| SMILES | Cc1c(/N=C2\NC(=O)/C(=C/c3ccc(Br)cc3)S2)c(=O)n(-c2ccccc2)n1C |
| InChI | InChI=1S/C21H17BrN4O2S/c1-13-18(20(28)26(25(13)2)16-6-4-3-5-7-16)23-21-24-19(27)17(29-21)12-14-8-10-15(22)11-9-14/h3-12H,1-2H3,(H,23,24,27)/b17-12- |
| InChIKey | PLXXXILDRZWHQL-ATVHPVEESA-N |
| XLogP | 4.14 |
| TPSA | 68.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.36 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|