C21H19N5OS — CID 135867755
(5Z)-2-(5-amino-3-methyl-1-phenylpyrazol-4-yl)imino-5-[(4-methylphenyl)methylidene]-1,3-thiazolidin-4-one (PubChem CID 135867755) has the molecular formula C21H19N5OS and a molecular weight of 389.48 g/mol. Its IUPAC name is (5Z)-2-(5-amino-3-methyl-1-phenylpyrazol-4-yl)imino-5-[(4-methylphenyl)methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-2-(5-amino-3-methyl-1-phenylpyrazol-4-yl)imino-5-[(4-methylphenyl)methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135867755 |
| Molecular Formula | C21H19N5OS |
| Molecular Weight | 389.48 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | (5Z)-2-(5-amino-3-methyl-1-phenylpyrazol-4-yl)imino-5-[(4-methylphenyl)methylidene]-1,3-thiazolidin-4-one |
| SMILES | Cc1ccc(/C=C2\S/C(=N/c3c(C)nn(-c4ccccc4)c3N)NC2=O)cc1 |
| InChI | InChI=1S/C21H19N5OS/c1-13-8-10-15(11-9-13)12-17-20(27)24-21(28-17)23-18-14(2)25-26(19(18)22)16-6-4-3-5-7-16/h3-12H,22H2,1-2H3,(H,23,24,27)/b17-12- |
| InChIKey | NBGOTRNPIXSVAP-ATVHPVEESA-N |
| XLogP | 3.96 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.48 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|