C32H31N5O6S — CID 135704691
(5Z)-2-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)imino-5-[(3-ethoxy-4-hydroxyphenyl)methylidene]-3-[(E)-(3-ethoxy-4-hydroxyphenyl)methylideneamino]-1,3-thiazolidin-4-one (PubChem CID 135704691) has the molecular formula C32H31N5O6S and a molecular weight of 613.70 g/mol. Its IUPAC name is (5Z)-2-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)imino-5-[(3-ethoxy-4-hydroxyphenyl)methylidene]-3-[(E)-(3-ethoxy-4-hydroxyphenyl)methylideneamino]-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-2-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)imino-5-[(3-ethoxy-4-hydroxyphenyl)methylidene]-3-[(E)-(3-ethoxy-4-hydroxyphenyl)methylideneamino]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135704691 |
| Molecular Formula | C32H31N5O6S |
| Molecular Weight | 613.70 g/mol |
| Exact Mass | 613.20 |
| IUPAC Name | (5Z)-2-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)imino-5-[(3-ethoxy-4-hydroxyphenyl)methylidene]-3-[(E)-(3-ethoxy-4-hydroxyphenyl)methylideneamino]-1,3-thiazolidin-4-one |
| SMILES | CCOc1cc(/C=C2\S/C(=N\c3c(C)n(C)n(-c4ccccc4)c3=O)N(/N=C/c3ccc(O)c(OCC)c3)C2=O)ccc1O |
| InChI | InChI=1S/C32H31N5O6S/c1-5-42-26-16-21(12-14-24(26)38)18-28-30(40)36(33-19-22-13-15-25(39)27(17-22)43-6-2)32(44-28)34-29-20(3)35(4)37(31(29)41)23-10-8-7-9-11-23/h7-19,38-39H,5-6H2,1-4H3/b28-18-,33-19+,34-32- |
| InChIKey | CKMCGRCDFYQBOC-JYIKEZOHSA-N |
| XLogP | 5.33 |
| TPSA | 130.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.70 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|