C29H26N4O4 — CID 1275177
4-[(4E)-4-[(3-ethoxy-4-hydroxyphenyl)methylidene]-5-oxo-2-phenylimidazol-1-yl]-1,5-dimethyl-2-phenylpyrazol-3-one (PubChem CID 1275177) has the molecular formula C29H26N4O4 and a molecular weight of 494.55 g/mol. Its IUPAC name is 4-[(4E)-4-[(3-ethoxy-4-hydroxyphenyl)methylidene]-5-oxo-2-phenylimidazol-1-yl]-1,5-dimethyl-2-phenylpyrazol-3-one.
| Compound Name | 4-[(4E)-4-[(3-ethoxy-4-hydroxyphenyl)methylidene]-5-oxo-2-phenylimidazol-1-yl]-1,5-dimethyl-2-phenylpyrazol-3-one |
|---|---|
| PubChem CID | 1275177 |
| Molecular Formula | C29H26N4O4 |
| Molecular Weight | 494.55 g/mol |
| Exact Mass | 494.20 |
| IUPAC Name | 4-[(4E)-4-[(3-ethoxy-4-hydroxyphenyl)methylidene]-5-oxo-2-phenylimidazol-1-yl]-1,5-dimethyl-2-phenylpyrazol-3-one |
| SMILES | CCOc1cc(/C=C2/N=C(c3ccccc3)N(c3c(C)n(C)n(-c4ccccc4)c3=O)C2=O)ccc1O |
| InChI | InChI=1S/C29H26N4O4/c1-4-37-25-18-20(15-16-24(25)34)17-23-28(35)32(27(30-23)21-11-7-5-8-12-21)26-19(2)31(3)33(29(26)36)22-13-9-6-10-14-22/h5-18,34H,4H2,1-3H3/b23-17+ |
| InChIKey | YSDGGBKKWAVJGN-HAVVHWLPSA-N |
| XLogP | 4.42 |
| TPSA | 89.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.55 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_het_G(10)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|