C29H28N2O5 — CID 3764375
methyl 4-[4-[(3,4-diethoxyphenyl)methylidene]-2-(4-methylphenyl)-5-oxoimidazol-1-yl]benzoate (PubChem CID 3764375) has the molecular formula C29H28N2O5 and a molecular weight of 484.55 g/mol. Its IUPAC name is methyl 4-[4-[(3,4-diethoxyphenyl)methylidene]-2-(4-methylphenyl)-5-oxoimidazol-1-yl]benzoate.
| Compound Name | methyl 4-[4-[(3,4-diethoxyphenyl)methylidene]-2-(4-methylphenyl)-5-oxoimidazol-1-yl]benzoate |
|---|---|
| PubChem CID | 3764375 |
| Molecular Formula | C29H28N2O5 |
| Molecular Weight | 484.55 g/mol |
| Exact Mass | 484.20 |
| IUPAC Name | methyl 4-[4-[(3,4-diethoxyphenyl)methylidene]-2-(4-methylphenyl)-5-oxoimidazol-1-yl]benzoate |
| SMILES | CCOc1ccc(C=C2N=C(c3ccc(C)cc3)N(c3ccc(C(=O)OC)cc3)C2=O)cc1OCC |
| InChI | InChI=1S/C29H28N2O5/c1-5-35-25-16-9-20(18-26(25)36-6-2)17-24-28(32)31(23-14-12-22(13-15-23)29(33)34-4)27(30-24)21-10-7-19(3)8-11-21/h7-18H,5-6H2,1-4H3 |
| InChIKey | KVULIJNSTYUSLE-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 77.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.55 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_G(10)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|