C22H24N2O3 — CID 1392036
(5E)-5-[(3,4-diethoxyphenyl)methylidene]-3-methyl-2-(4-methylphenyl)imidazol-4-one (PubChem CID 1392036) has the molecular formula C22H24N2O3 and a molecular weight of 364.45 g/mol. Its IUPAC name is (5E)-5-[(3,4-diethoxyphenyl)methylidene]-3-methyl-2-(4-methylphenyl)imidazol-4-one.
| Compound Name | (5E)-5-[(3,4-diethoxyphenyl)methylidene]-3-methyl-2-(4-methylphenyl)imidazol-4-one |
|---|---|
| PubChem CID | 1392036 |
| Molecular Formula | C22H24N2O3 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | (5E)-5-[(3,4-diethoxyphenyl)methylidene]-3-methyl-2-(4-methylphenyl)imidazol-4-one |
| SMILES | CCOc1ccc(/C=C2/N=C(c3ccc(C)cc3)N(C)C2=O)cc1OCC |
| InChI | InChI=1S/C22H24N2O3/c1-5-26-19-12-9-16(14-20(19)27-6-2)13-18-22(25)24(4)21(23-18)17-10-7-15(3)8-11-17/h7-14H,5-6H2,1-4H3/b18-13+ |
| InChIKey | XCFQGDCJMSMACJ-QGOAFFKASA-N |
| XLogP | 4.05 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|