C24H25ClN2O5 — CID 4015764
2-[2-(4-chlorophenyl)-4-[(3,4-diethoxyphenyl)methylidene]-5-oxoimidazol-1-yl]ethyl acetate (PubChem CID 4015764) has the molecular formula C24H25ClN2O5 and a molecular weight of 456.93 g/mol. Its IUPAC name is 2-[2-(4-chlorophenyl)-4-[(3,4-diethoxyphenyl)methylidene]-5-oxoimidazol-1-yl]ethyl acetate.
| Compound Name | 2-[2-(4-chlorophenyl)-4-[(3,4-diethoxyphenyl)methylidene]-5-oxoimidazol-1-yl]ethyl acetate |
|---|---|
| PubChem CID | 4015764 |
| Molecular Formula | C24H25ClN2O5 |
| Molecular Weight | 456.93 g/mol |
| Exact Mass | 456.15 |
| IUPAC Name | 2-[2-(4-chlorophenyl)-4-[(3,4-diethoxyphenyl)methylidene]-5-oxoimidazol-1-yl]ethyl acetate |
| SMILES | CCOc1ccc(C=C2N=C(c3ccc(Cl)cc3)N(CCOC(C)=O)C2=O)cc1OCC |
| InChI | InChI=1S/C24H25ClN2O5/c1-4-30-21-11-6-17(15-22(21)31-5-2)14-20-24(29)27(12-13-32-16(3)28)23(26-20)18-7-9-19(25)10-8-18/h6-11,14-15H,4-5,12-13H2,1-3H3 |
| InChIKey | FDGAXPLOPRLIRI-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 77.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.93 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|