C44H46N4O6 — CID 4874677
2-(4-butoxyphenyl)-3-[2-[2-(4-butoxyphenyl)-4-[(4-methoxyphenyl)methylidene]-5-oxoimidazol-1-yl]ethyl]-5-[(4-methoxyphenyl)methylidene]imidazol-4-one (PubChem CID 4874677) has the molecular formula C44H46N4O6 and a molecular weight of 726.87 g/mol. Its IUPAC name is 2-(4-butoxyphenyl)-3-[2-[2-(4-butoxyphenyl)-4-[(4-methoxyphenyl)methylidene]-5-oxoimidazol-1-yl]ethyl]-5-[(4-methoxyphenyl)methylidene]imidazol-4-one.
| Compound Name | 2-(4-butoxyphenyl)-3-[2-[2-(4-butoxyphenyl)-4-[(4-methoxyphenyl)methylidene]-5-oxoimidazol-1-yl]ethyl]-5-[(4-methoxyphenyl)methylidene]imidazol-4-one |
|---|---|
| PubChem CID | 4874677 |
| Molecular Formula | C44H46N4O6 |
| Molecular Weight | 726.87 g/mol |
| Exact Mass | 726.34 |
| IUPAC Name | 2-(4-butoxyphenyl)-3-[2-[2-(4-butoxyphenyl)-4-[(4-methoxyphenyl)methylidene]-5-oxoimidazol-1-yl]ethyl]-5-[(4-methoxyphenyl)methylidene]imidazol-4-one |
| SMILES | CCCCOc1ccc(C2=NC(=Cc3ccc(OC)cc3)C(=O)N2CCN2C(=O)C(=Cc3ccc(OC)cc3)N=C2c2ccc(OCCCC)cc2)cc1 |
| InChI | InChI=1S/C44H46N4O6/c1-5-7-27-53-37-21-13-33(14-22-37)41-45-39(29-31-9-17-35(51-3)18-10-31)43(49)47(41)25-26-48-42(34-15-23-38(24-16-34)54-28-8-6-2)46-40(44(48)50)30-32-11-19-36(52-4)20-12-32/h9-24,29-30H,5-8,25-28H2,1-4H3 |
| InChIKey | SIQZQQHZVAELMM-UHFFFAOYSA-N |
| XLogP | 8.02 |
| TPSA | 102.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.87 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|