C40H36Br2N4O4 — CID 4874714
2-(2-bromophenyl)-3-[6-[2-(2-bromophenyl)-4-[(4-methoxyphenyl)methylidene]-5-oxoimidazol-1-yl]hexyl]-5-[(4-methoxyphenyl)methylidene]imidazol-4-one (PubChem CID 4874714) has the molecular formula C40H36Br2N4O4 and a molecular weight of 796.56 g/mol. Its IUPAC name is 2-(2-bromophenyl)-3-[6-[2-(2-bromophenyl)-4-[(4-methoxyphenyl)methylidene]-5-oxoimidazol-1-yl]hexyl]-5-[(4-methoxyphenyl)methylidene]imidazol-4-one.
| Compound Name | 2-(2-bromophenyl)-3-[6-[2-(2-bromophenyl)-4-[(4-methoxyphenyl)methylidene]-5-oxoimidazol-1-yl]hexyl]-5-[(4-methoxyphenyl)methylidene]imidazol-4-one |
|---|---|
| PubChem CID | 4874714 |
| Molecular Formula | C40H36Br2N4O4 |
| Molecular Weight | 796.56 g/mol |
| Exact Mass | 794.11 |
| IUPAC Name | 2-(2-bromophenyl)-3-[6-[2-(2-bromophenyl)-4-[(4-methoxyphenyl)methylidene]-5-oxoimidazol-1-yl]hexyl]-5-[(4-methoxyphenyl)methylidene]imidazol-4-one |
| SMILES | COc1ccc(C=C2N=C(c3ccccc3Br)N(CCCCCCN3C(=O)C(=Cc4ccc(OC)cc4)N=C3c3ccccc3Br)C2=O)cc1 |
| InChI | InChI=1S/C40H36Br2N4O4/c1-49-29-19-15-27(16-20-29)25-35-39(47)45(37(43-35)31-11-5-7-13-33(31)41)23-9-3-4-10-24-46-38(32-12-6-8-14-34(32)42)44-36(40(46)48)26-28-17-21-30(50-2)22-18-28/h5-8,11-22,25-26H,3-4,9-10,23-24H2,1-2H3 |
| InChIKey | PGIYQXKLAFCWEJ-UHFFFAOYSA-N |
| XLogP | 8.75 |
| TPSA | 83.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 796.56 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|