C20H17BrN2O3 — CID 134824256
4-[(4Z)-4-[(4-bromophenyl)methylidene]-5-oxo-2-phenylimidazol-1-yl]butanoic acid (PubChem CID 134824256) has the molecular formula C20H17BrN2O3 and a molecular weight of 413.27 g/mol. Its IUPAC name is 4-[(4Z)-4-[(4-bromophenyl)methylidene]-5-oxo-2-phenylimidazol-1-yl]butanoic acid.
| Compound Name | 4-[(4Z)-4-[(4-bromophenyl)methylidene]-5-oxo-2-phenylimidazol-1-yl]butanoic acid |
|---|---|
| PubChem CID | 134824256 |
| Molecular Formula | C20H17BrN2O3 |
| Molecular Weight | 413.27 g/mol |
| Exact Mass | 412.04 |
| IUPAC Name | 4-[(4Z)-4-[(4-bromophenyl)methylidene]-5-oxo-2-phenylimidazol-1-yl]butanoic acid |
| SMILES | O=C(O)CCCN1C(=O)/C(=C/c2ccc(Br)cc2)N=C1c1ccccc1 |
| InChI | InChI=1S/C20H17BrN2O3/c21-16-10-8-14(9-11-16)13-17-20(26)23(12-4-7-18(24)25)19(22-17)15-5-2-1-3-6-15/h1-3,5-6,8-11,13H,4,7,12H2,(H,24,25)/b17-13- |
| InChIKey | YLSFJSOSTADWEG-LGMDPLHJSA-N |
| XLogP | 3.94 |
| TPSA | 69.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.27 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|