C36H46N6O8 — CID 6447286
bis(4-[(4E)-4-[(4-methoxyphenyl)methylidene]-2-methyl-5-oxoimidazol-1-yl]butanoic acid);piperazine (PubChem CID 6447286) has the molecular formula C36H46N6O8 and a molecular weight of 690.80 g/mol. Its IUPAC name is bis(4-[(4E)-4-[(4-methoxyphenyl)methylidene]-2-methyl-5-oxoimidazol-1-yl]butanoic acid);piperazine.
| Compound Name | bis(4-[(4E)-4-[(4-methoxyphenyl)methylidene]-2-methyl-5-oxoimidazol-1-yl]butanoic acid);piperazine |
|---|---|
| PubChem CID | 6447286 |
| Molecular Formula | C36H46N6O8 |
| Molecular Weight | 690.80 g/mol |
| Exact Mass | 690.34 |
| IUPAC Name | bis(4-[(4E)-4-[(4-methoxyphenyl)methylidene]-2-methyl-5-oxoimidazol-1-yl]butanoic acid);piperazine |
| SMILES | C1CNCCN1.COc1ccc(/C=C2/N=C(C)N(CCCC(=O)O)C2=O)cc1.COc1ccc(/C=C2/N=C(C)N(CCCC(=O)O)C2=O)cc1 |
| InChI | InChI=1S/2C16H18N2O4.C4H10N2/c2*1-11-17-14(10-12-5-7-13(22-2)8-6-12)16(21)18(11)9-3-4-15(19)20;1-2-6-4-3-5-1/h2*5-8,10H,3-4,9H2,1-2H3,(H,19,20);5-6H,1-4H2/b2*14-10+; |
| InChIKey | JWFKYLJIHFOCDN-XGNDVENUSA-N |
| XLogP | 3.50 |
| TPSA | 182.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.80 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|