C30H28N4O5 — CID 1274959
1,5-dimethyl-4-[5-oxo-2-phenyl-4-[(3,4,5-trimethoxyphenyl)methylidene]imidazol-1-yl]-2-phenylpyrazol-3-one (PubChem CID 1274959) has the molecular formula C30H28N4O5 and a molecular weight of 524.58 g/mol. Its IUPAC name is 1,5-dimethyl-4-[5-oxo-2-phenyl-4-[(3,4,5-trimethoxyphenyl)methylidene]imidazol-1-yl]-2-phenylpyrazol-3-one.
| Compound Name | 1,5-dimethyl-4-[5-oxo-2-phenyl-4-[(3,4,5-trimethoxyphenyl)methylidene]imidazol-1-yl]-2-phenylpyrazol-3-one |
|---|---|
| PubChem CID | 1274959 |
| Molecular Formula | C30H28N4O5 |
| Molecular Weight | 524.58 g/mol |
| Exact Mass | 524.21 |
| IUPAC Name | 1,5-dimethyl-4-[5-oxo-2-phenyl-4-[(3,4,5-trimethoxyphenyl)methylidene]imidazol-1-yl]-2-phenylpyrazol-3-one |
| SMILES | COc1cc(C=C2N=C(c3ccccc3)N(c3c(C)n(C)n(-c4ccccc4)c3=O)C2=O)cc(OC)c1OC |
| InChI | InChI=1S/C30H28N4O5/c1-19-26(30(36)34(32(19)2)22-14-10-7-11-15-22)33-28(21-12-8-6-9-13-21)31-23(29(33)35)16-20-17-24(37-3)27(39-5)25(18-20)38-4/h6-18H,1-5H3 |
| InChIKey | MSQJDZCLPLEIQW-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 87.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.58 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_five_het_G(10)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|