C28H28N4O5S — CID 11734170
1-(2-methoxy-5-methylphenyl)-3-[(4Z)-5-oxo-2-phenyl-4-[(3,4,5-trimethoxyphenyl)methylidene]imidazol-1-yl]thiourea (PubChem CID 11734170) has the molecular formula C28H28N4O5S and a molecular weight of 532.62 g/mol. Its IUPAC name is 1-(2-methoxy-5-methylphenyl)-3-[(4Z)-5-oxo-2-phenyl-4-[(3,4,5-trimethoxyphenyl)methylidene]imidazol-1-yl]thiourea.
| Compound Name | 1-(2-methoxy-5-methylphenyl)-3-[(4Z)-5-oxo-2-phenyl-4-[(3,4,5-trimethoxyphenyl)methylidene]imidazol-1-yl]thiourea |
|---|---|
| PubChem CID | 11734170 |
| Molecular Formula | C28H28N4O5S |
| Molecular Weight | 532.62 g/mol |
| Exact Mass | 532.18 |
| IUPAC Name | 1-(2-methoxy-5-methylphenyl)-3-[(4Z)-5-oxo-2-phenyl-4-[(3,4,5-trimethoxyphenyl)methylidene]imidazol-1-yl]thiourea |
| SMILES | COc1ccc(C)cc1NC(=S)NN1C(=O)/C(=C/c2cc(OC)c(OC)c(OC)c2)N=C1c1ccccc1 |
| InChI | InChI=1S/C28H28N4O5S/c1-17-11-12-22(34-2)20(13-17)30-28(38)31-32-26(19-9-7-6-8-10-19)29-21(27(32)33)14-18-15-23(35-3)25(37-5)24(16-18)36-4/h6-16H,1-5H3,(H2,30,31,38)/b21-14- |
| InChIKey | GRSLMESCILOCDL-STZFKDTASA-N |
| XLogP | 4.56 |
| TPSA | 93.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.62 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|