C30H30N4O7 — CID 5472082
4-acetamido-2-ethoxy-N-[(4Z)-5-oxo-2-phenyl-4-[(3,4,5-trimethoxyphenyl)methylidene]imidazol-1-yl]benzamide (PubChem CID 5472082) has the molecular formula C30H30N4O7 and a molecular weight of 558.59 g/mol. Its IUPAC name is 4-acetamido-2-ethoxy-N-[(4Z)-5-oxo-2-phenyl-4-[(3,4,5-trimethoxyphenyl)methylidene]imidazol-1-yl]benzamide.
| Compound Name | 4-acetamido-2-ethoxy-N-[(4Z)-5-oxo-2-phenyl-4-[(3,4,5-trimethoxyphenyl)methylidene]imidazol-1-yl]benzamide |
|---|---|
| PubChem CID | 5472082 |
| Molecular Formula | C30H30N4O7 |
| Molecular Weight | 558.59 g/mol |
| Exact Mass | 558.21 |
| IUPAC Name | 4-acetamido-2-ethoxy-N-[(4Z)-5-oxo-2-phenyl-4-[(3,4,5-trimethoxyphenyl)methylidene]imidazol-1-yl]benzamide |
| SMILES | CCOc1cc(NC(C)=O)ccc1C(=O)NN1C(=O)/C(=C/c2cc(OC)c(OC)c(OC)c2)N=C1c1ccccc1 |
| InChI | InChI=1S/C30H30N4O7/c1-6-41-24-17-21(31-18(2)35)12-13-22(24)29(36)33-34-28(20-10-8-7-9-11-20)32-23(30(34)37)14-19-15-25(38-3)27(40-5)26(16-19)39-4/h7-17H,6H2,1-5H3,(H,31,35)(H,33,36)/b23-14- |
| InChIKey | XTIRDAYORCDVIK-UCQKPKSFSA-N |
| XLogP | 4.04 |
| TPSA | 127.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.59 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|