C22H26N4O6 — CID 1276901
N-[4-[[[(S)-cyano-(3,4,5-trimethoxyphenyl)methyl]amino]carbamoyl]-3-ethoxyphenyl]acetamide (PubChem CID 1276901) has the molecular formula C22H26N4O6 and a molecular weight of 442.47 g/mol. Its IUPAC name is N-[4-[[[(S)-cyano-(3,4,5-trimethoxyphenyl)methyl]amino]carbamoyl]-3-ethoxyphenyl]acetamide.
| Compound Name | N-[4-[[[(S)-cyano-(3,4,5-trimethoxyphenyl)methyl]amino]carbamoyl]-3-ethoxyphenyl]acetamide |
|---|---|
| PubChem CID | 1276901 |
| Molecular Formula | C22H26N4O6 |
| Molecular Weight | 442.47 g/mol |
| Exact Mass | 442.19 |
| IUPAC Name | N-[4-[[[(S)-cyano-(3,4,5-trimethoxyphenyl)methyl]amino]carbamoyl]-3-ethoxyphenyl]acetamide |
| SMILES | CCOc1cc(NC(C)=O)ccc1C(=O)NN[C@H](C#N)c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C22H26N4O6/c1-6-32-18-11-15(24-13(2)27)7-8-16(18)22(28)26-25-17(12-23)14-9-19(29-3)21(31-5)20(10-14)30-4/h7-11,17,25H,6H2,1-5H3,(H,24,27)(H,26,28)/t17-/m1/s1 |
| InChIKey | GTSUKUGHZWPXLQ-QGZVFWFLSA-N |
| XLogP | 2.57 |
| TPSA | 130.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.47 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|