C20H22N4O3S — CID 1276906
N-[4-[[[(R)-cyano-(4-methylsulfanylphenyl)methyl]amino]carbamoyl]-3-ethoxyphenyl]acetamide (PubChem CID 1276906) has the molecular formula C20H22N4O3S and a molecular weight of 398.49 g/mol. Its IUPAC name is N-[4-[[[(R)-cyano-(4-methylsulfanylphenyl)methyl]amino]carbamoyl]-3-ethoxyphenyl]acetamide.
| Compound Name | N-[4-[[[(R)-cyano-(4-methylsulfanylphenyl)methyl]amino]carbamoyl]-3-ethoxyphenyl]acetamide |
|---|---|
| PubChem CID | 1276906 |
| Molecular Formula | C20H22N4O3S |
| Molecular Weight | 398.49 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | N-[4-[[[(R)-cyano-(4-methylsulfanylphenyl)methyl]amino]carbamoyl]-3-ethoxyphenyl]acetamide |
| SMILES | CCOc1cc(NC(C)=O)ccc1C(=O)NN[C@@H](C#N)c1ccc(SC)cc1 |
| InChI | InChI=1S/C20H22N4O3S/c1-4-27-19-11-15(22-13(2)25)7-10-17(19)20(26)24-23-18(12-21)14-5-8-16(28-3)9-6-14/h5-11,18,23H,4H2,1-3H3,(H,22,25)(H,24,26)/t18-/m0/s1 |
| InChIKey | PVRXHRQIXQSDFP-SFHVURJKSA-N |
| XLogP | 3.26 |
| TPSA | 103.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.49 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|