C21H28N2O6 — CID 55362391
N-(3,4-diethoxyphenyl)-2-(3,4,5-trimethoxyanilino)acetamide (PubChem CID 55362391) has the molecular formula C21H28N2O6 and a molecular weight of 404.46 g/mol. Its IUPAC name is N-(3,4-diethoxyphenyl)-2-(3,4,5-trimethoxyanilino)acetamide.
| Compound Name | N-(3,4-diethoxyphenyl)-2-(3,4,5-trimethoxyanilino)acetamide |
|---|---|
| PubChem CID | 55362391 |
| Molecular Formula | C21H28N2O6 |
| Molecular Weight | 404.46 g/mol |
| Exact Mass | 404.19 |
| IUPAC Name | N-(3,4-diethoxyphenyl)-2-(3,4,5-trimethoxyanilino)acetamide |
| SMILES | CCOc1ccc(NC(=O)CNc2cc(OC)c(OC)c(OC)c2)cc1OCC |
| InChI | InChI=1S/C21H28N2O6/c1-6-28-16-9-8-14(10-17(16)29-7-2)23-20(24)13-22-15-11-18(25-3)21(27-5)19(12-15)26-4/h8-12,22H,6-7,13H2,1-5H3,(H,23,24) |
| InChIKey | MXOMTLYBHGDAJZ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 87.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.46 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|