C27H25ClN2O6 — CID 45105660
(5Z)-2-(4-chlorophenyl)-3-(3,4-dimethoxyphenyl)-5-[(3,4,5-trimethoxyphenyl)methylidene]imidazol-4-one (PubChem CID 45105660) has the molecular formula C27H25ClN2O6 and a molecular weight of 508.96 g/mol. Its IUPAC name is (5Z)-2-(4-chlorophenyl)-3-(3,4-dimethoxyphenyl)-5-[(3,4,5-trimethoxyphenyl)methylidene]imidazol-4-one.
| Compound Name | (5Z)-2-(4-chlorophenyl)-3-(3,4-dimethoxyphenyl)-5-[(3,4,5-trimethoxyphenyl)methylidene]imidazol-4-one |
|---|---|
| PubChem CID | 45105660 |
| Molecular Formula | C27H25ClN2O6 |
| Molecular Weight | 508.96 g/mol |
| Exact Mass | 508.14 |
| IUPAC Name | (5Z)-2-(4-chlorophenyl)-3-(3,4-dimethoxyphenyl)-5-[(3,4,5-trimethoxyphenyl)methylidene]imidazol-4-one |
| SMILES | COc1ccc(N2C(=O)/C(=C/c3cc(OC)c(OC)c(OC)c3)N=C2c2ccc(Cl)cc2)cc1OC |
| InChI | InChI=1S/C27H25ClN2O6/c1-32-21-11-10-19(15-22(21)33-2)30-26(17-6-8-18(28)9-7-17)29-20(27(30)31)12-16-13-23(34-3)25(36-5)24(14-16)35-4/h6-15H,1-5H3/b20-12- |
| InChIKey | BPRLSXAJTUVYLF-NDENLUEZSA-N |
| XLogP | 5.22 |
| TPSA | 78.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.96 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_het_G(10)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|