C26H19Cl2N3O4S — CID 5100365
3-(5,6-dichloro-1,3-benzothiazol-2-yl)-2-phenyl-5-[(3,4,5-trimethoxyphenyl)methylidene]imidazol-4-one (PubChem CID 5100365) has the molecular formula C26H19Cl2N3O4S and a molecular weight of 540.43 g/mol. Its IUPAC name is 3-(5,6-dichloro-1,3-benzothiazol-2-yl)-2-phenyl-5-[(3,4,5-trimethoxyphenyl)methylidene]imidazol-4-one.
| Compound Name | 3-(5,6-dichloro-1,3-benzothiazol-2-yl)-2-phenyl-5-[(3,4,5-trimethoxyphenyl)methylidene]imidazol-4-one |
|---|---|
| PubChem CID | 5100365 |
| Molecular Formula | C26H19Cl2N3O4S |
| Molecular Weight | 540.43 g/mol |
| Exact Mass | 539.05 |
| IUPAC Name | 3-(5,6-dichloro-1,3-benzothiazol-2-yl)-2-phenyl-5-[(3,4,5-trimethoxyphenyl)methylidene]imidazol-4-one |
| SMILES | COc1cc(C=C2N=C(c3ccccc3)N(c3nc4cc(Cl)c(Cl)cc4s3)C2=O)cc(OC)c1OC |
| InChI | InChI=1S/C26H19Cl2N3O4S/c1-33-20-10-14(11-21(34-2)23(20)35-3)9-19-25(32)31(24(29-19)15-7-5-4-6-8-15)26-30-18-12-16(27)17(28)13-22(18)36-26/h4-13H,1-3H3 |
| InChIKey | QSNCFOZTSIXAOX-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 73.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.43 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_het_G(10)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|