C23H14ClN3O2S — CID 3564511
3-(5-chloro-1,3-benzothiazol-2-yl)-5-[(2-hydroxyphenyl)methylidene]-2-phenylimidazol-4-one (PubChem CID 3564511) has the molecular formula C23H14ClN3O2S and a molecular weight of 431.90 g/mol. Its IUPAC name is 3-(5-chloro-1,3-benzothiazol-2-yl)-5-[(2-hydroxyphenyl)methylidene]-2-phenylimidazol-4-one.
| Compound Name | 3-(5-chloro-1,3-benzothiazol-2-yl)-5-[(2-hydroxyphenyl)methylidene]-2-phenylimidazol-4-one |
|---|---|
| PubChem CID | 3564511 |
| Molecular Formula | C23H14ClN3O2S |
| Molecular Weight | 431.90 g/mol |
| Exact Mass | 431.05 |
| IUPAC Name | 3-(5-chloro-1,3-benzothiazol-2-yl)-5-[(2-hydroxyphenyl)methylidene]-2-phenylimidazol-4-one |
| SMILES | O=C1C(=Cc2ccccc2O)N=C(c2ccccc2)N1c1nc2cc(Cl)ccc2s1 |
| InChI | InChI=1S/C23H14ClN3O2S/c24-16-10-11-20-17(13-16)26-23(30-20)27-21(14-6-2-1-3-7-14)25-18(22(27)29)12-15-8-4-5-9-19(15)28/h1-13,28H |
| InChIKey | DWOHPJKGRLQQHJ-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 65.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.90 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_G(10)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|