C25H19Cl2N3O2 — CID 26476937
N-[4-[(4E)-4-[(2,4-dichlorophenyl)methylidene]-5-oxo-2-phenylimidazol-1-yl]phenyl]-N-methylacetamide (PubChem CID 26476937) has the molecular formula C25H19Cl2N3O2 and a molecular weight of 464.35 g/mol. Its IUPAC name is N-[4-[(4E)-4-[(2,4-dichlorophenyl)methylidene]-5-oxo-2-phenylimidazol-1-yl]phenyl]-N-methylacetamide.
| Compound Name | N-[4-[(4E)-4-[(2,4-dichlorophenyl)methylidene]-5-oxo-2-phenylimidazol-1-yl]phenyl]-N-methylacetamide |
|---|---|
| PubChem CID | 26476937 |
| Molecular Formula | C25H19Cl2N3O2 |
| Molecular Weight | 464.35 g/mol |
| Exact Mass | 463.09 |
| IUPAC Name | N-[4-[(4E)-4-[(2,4-dichlorophenyl)methylidene]-5-oxo-2-phenylimidazol-1-yl]phenyl]-N-methylacetamide |
| SMILES | CC(=O)N(C)c1ccc(N2C(=O)/C(=C\c3ccc(Cl)cc3Cl)N=C2c2ccccc2)cc1 |
| InChI | InChI=1S/C25H19Cl2N3O2/c1-16(31)29(2)20-10-12-21(13-11-20)30-24(17-6-4-3-5-7-17)28-23(25(30)32)14-18-8-9-19(26)15-22(18)27/h3-15H,1-2H3/b23-14+ |
| InChIKey | VJKWMDNJDBYNPC-OEAKJJBVSA-N |
| XLogP | 5.81 |
| TPSA | 52.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.35 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_five_het_G(10)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|