C33H27N3O2 — CID 23735542
4-[(2,4-diphenyl-4H-chromen-3-yl)methylideneamino]-1,5-dimethyl-2-phenylpyrazol-3-one (PubChem CID 23735542) has the molecular formula C33H27N3O2 and a molecular weight of 497.60 g/mol. Its IUPAC name is 4-[(2,4-diphenyl-4H-chromen-3-yl)methylideneamino]-1,5-dimethyl-2-phenylpyrazol-3-one.
| Compound Name | 4-[(2,4-diphenyl-4H-chromen-3-yl)methylideneamino]-1,5-dimethyl-2-phenylpyrazol-3-one |
|---|---|
| PubChem CID | 23735542 |
| Molecular Formula | C33H27N3O2 |
| Molecular Weight | 497.60 g/mol |
| Exact Mass | 497.21 |
| IUPAC Name | 4-[(2,4-diphenyl-4H-chromen-3-yl)methylideneamino]-1,5-dimethyl-2-phenylpyrazol-3-one |
| SMILES | Cc1c(/N=C/C2=C(c3ccccc3)Oc3ccccc3C2c2ccccc2)c(=O)n(-c2ccccc2)n1C |
| InChI | InChI=1S/C33H27N3O2/c1-23-31(33(37)36(35(23)2)26-18-10-5-11-19-26)34-22-28-30(24-14-6-3-7-15-24)27-20-12-13-21-29(27)38-32(28)25-16-8-4-9-17-25/h3-22,30H,1-2H3/b34-22+ |
| InChIKey | PGFQTOHQRUKNHN-PPOKSSTKSA-N |
| XLogP | 6.82 |
| TPSA | 48.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.60 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|