C35H31N3O3 — CID 23852582
4-[[2-(4-ethoxyphenyl)-4-phenyl-4H-chromen-3-yl]methylideneamino]-1,5-dimethyl-2-phenylpyrazol-3-one (PubChem CID 23852582) has the molecular formula C35H31N3O3 and a molecular weight of 541.65 g/mol. Its IUPAC name is 4-[[2-(4-ethoxyphenyl)-4-phenyl-4H-chromen-3-yl]methylideneamino]-1,5-dimethyl-2-phenylpyrazol-3-one.
| Compound Name | 4-[[2-(4-ethoxyphenyl)-4-phenyl-4H-chromen-3-yl]methylideneamino]-1,5-dimethyl-2-phenylpyrazol-3-one |
|---|---|
| PubChem CID | 23852582 |
| Molecular Formula | C35H31N3O3 |
| Molecular Weight | 541.65 g/mol |
| Exact Mass | 541.24 |
| IUPAC Name | 4-[[2-(4-ethoxyphenyl)-4-phenyl-4H-chromen-3-yl]methylideneamino]-1,5-dimethyl-2-phenylpyrazol-3-one |
| SMILES | CCOc1ccc(C2=C(/C=N/c3c(C)n(C)n(-c4ccccc4)c3=O)C(c3ccccc3)c3ccccc3O2)cc1 |
| InChI | InChI=1S/C35H31N3O3/c1-4-40-28-21-19-26(20-22-28)34-30(32(25-13-7-5-8-14-25)29-17-11-12-18-31(29)41-34)23-36-33-24(2)37(3)38(35(33)39)27-15-9-6-10-16-27/h5-23,32H,4H2,1-3H3/b36-23+ |
| InChIKey | YAJPMUCWDVKQTD-GOJREDGKSA-N |
| XLogP | 7.22 |
| TPSA | 57.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.65 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|