C25H22O3 — CID 1362893
(4S)-2-(4-ethoxyphenyl)-4-(4-methylphenyl)-4H-chromene-3-carbaldehyde (PubChem CID 1362893) has the molecular formula C25H22O3 and a molecular weight of 370.45 g/mol. Its IUPAC name is (4S)-2-(4-ethoxyphenyl)-4-(4-methylphenyl)-4H-chromene-3-carbaldehyde.
| Compound Name | (4S)-2-(4-ethoxyphenyl)-4-(4-methylphenyl)-4H-chromene-3-carbaldehyde |
|---|---|
| PubChem CID | 1362893 |
| Molecular Formula | C25H22O3 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | (4S)-2-(4-ethoxyphenyl)-4-(4-methylphenyl)-4H-chromene-3-carbaldehyde |
| SMILES | CCOc1ccc(C2=C(C=O)[C@@H](c3ccc(C)cc3)c3ccccc3O2)cc1 |
| InChI | InChI=1S/C25H22O3/c1-3-27-20-14-12-19(13-15-20)25-22(16-26)24(18-10-8-17(2)9-11-18)21-6-4-5-7-23(21)28-25/h4-16,24H,3H2,1-2H3/t24-/m0/s1 |
| InChIKey | ORHZJONNKBSDCN-DEOSSOPVSA-N |
| XLogP | 5.53 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|