C30H23FO3S — CID 92911906
(Z)-3-[(4S)-2-(4-ethoxyphenyl)-4-(4-fluorophenyl)-4H-chromen-3-yl]-1-thiophen-2-ylprop-2-en-1-one (PubChem CID 92911906) has the molecular formula C30H23FO3S and a molecular weight of 482.58 g/mol. Its IUPAC name is (Z)-3-[(4S)-2-(4-ethoxyphenyl)-4-(4-fluorophenyl)-4H-chromen-3-yl]-1-thiophen-2-ylprop-2-en-1-one.
| Compound Name | (Z)-3-[(4S)-2-(4-ethoxyphenyl)-4-(4-fluorophenyl)-4H-chromen-3-yl]-1-thiophen-2-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 92911906 |
| Molecular Formula | C30H23FO3S |
| Molecular Weight | 482.58 g/mol |
| Exact Mass | 482.14 |
| IUPAC Name | (Z)-3-[(4S)-2-(4-ethoxyphenyl)-4-(4-fluorophenyl)-4H-chromen-3-yl]-1-thiophen-2-ylprop-2-en-1-one |
| SMILES | CCOc1ccc(C2=C(/C=C\C(=O)c3cccs3)[C@@H](c3ccc(F)cc3)c3ccccc3O2)cc1 |
| InChI | InChI=1S/C30H23FO3S/c1-2-33-23-15-11-21(12-16-23)30-25(17-18-26(32)28-8-5-19-35-28)29(20-9-13-22(31)14-10-20)24-6-3-4-7-27(24)34-30/h3-19,29H,2H2,1H3/b18-17-/t29-/m0/s1 |
| InChIKey | ZPWZYRIVWMVFRR-MAABLUSNSA-N |
| XLogP | 7.66 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.58 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|