C24H20N2O2 — CID 545080
1,5-dimethyl-2-phenyl-4-(9H-xanthen-9-yl)pyrazol-3-one (PubChem CID 545080) has the molecular formula C24H20N2O2 and a molecular weight of 368.44 g/mol. Its IUPAC name is 1,5-dimethyl-2-phenyl-4-(9H-xanthen-9-yl)pyrazol-3-one.
| Compound Name | 1,5-dimethyl-2-phenyl-4-(9H-xanthen-9-yl)pyrazol-3-one |
|---|---|
| PubChem CID | 545080 |
| Molecular Formula | C24H20N2O2 |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | 1,5-dimethyl-2-phenyl-4-(9H-xanthen-9-yl)pyrazol-3-one |
| SMILES | Cc1c(C2c3ccccc3Oc3ccccc32)c(=O)n(-c2ccccc2)n1C |
| InChI | InChI=1S/C24H20N2O2/c1-16-22(24(27)26(25(16)2)17-10-4-3-5-11-17)23-18-12-6-8-14-20(18)28-21-15-9-7-13-19(21)23/h3-15,23H,1-2H3 |
| InChIKey | LEOXQGXJNASPOX-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 36.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |