C34H38N2O4 — CID 90484932
benzene;9-(1,3-dimethyl-5-oxo-2-phenylpyrazol-4-yl)-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-xanthene-1,8-dione (PubChem CID 90484932) has the molecular formula C34H38N2O4 and a molecular weight of 538.69 g/mol. Its IUPAC name is benzene;9-(1,3-dimethyl-5-oxo-2-phenylpyrazol-4-yl)-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-xanthene-1,8-dione.
| Compound Name | benzene;9-(1,3-dimethyl-5-oxo-2-phenylpyrazol-4-yl)-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-xanthene-1,8-dione |
|---|---|
| PubChem CID | 90484932 |
| Molecular Formula | C34H38N2O4 |
| Molecular Weight | 538.69 g/mol |
| Exact Mass | 538.28 |
| IUPAC Name | benzene;9-(1,3-dimethyl-5-oxo-2-phenylpyrazol-4-yl)-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-xanthene-1,8-dione |
| SMILES | Cc1c(C2C3=C(CC(C)(C)CC3=O)OC3=C2C(=O)CC(C)(C)C3)c(=O)n(C)n1-c1ccccc1.c1ccccc1 |
| InChI | InChI=1S/C28H32N2O4.C6H6/c1-16-22(26(33)29(6)30(16)17-10-8-7-9-11-17)25-23-18(31)12-27(2,3)14-20(23)34-21-15-28(4,5)13-19(32)24(21)25;1-2-4-6-5-3-1/h7-11,25H,12-15H2,1-6H3;1-6H |
| InChIKey | PGHADAJZTWYUNF-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 70.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.69 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |