C20H19NO4 — CID 57149722
2,8,8-trimethyl-5-phenyl-7,9-dihydro-5H-chromeno[2,3-d][1,3]oxazine-4,6-dione (PubChem CID 57149722) has the molecular formula C20H19NO4 and a molecular weight of 337.38 g/mol. Its IUPAC name is 2,8,8-trimethyl-5-phenyl-7,9-dihydro-5H-chromeno[2,3-d][1,3]oxazine-4,6-dione.
| Compound Name | 2,8,8-trimethyl-5-phenyl-7,9-dihydro-5H-chromeno[2,3-d][1,3]oxazine-4,6-dione |
|---|---|
| PubChem CID | 57149722 |
| Molecular Formula | C20H19NO4 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | 2,8,8-trimethyl-5-phenyl-7,9-dihydro-5H-chromeno[2,3-d][1,3]oxazine-4,6-dione |
| SMILES | Cc1nc2c(c(=O)o1)C(c1ccccc1)C1=C(CC(C)(C)CC1=O)O2 |
| InChI | InChI=1S/C20H19NO4/c1-11-21-18-17(19(23)24-11)15(12-7-5-4-6-8-12)16-13(22)9-20(2,3)10-14(16)25-18/h4-8,15H,9-10H2,1-3H3 |
| InChIKey | MBZYYBSRRLAJAP-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 69.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |