C21H24N3O3+ — CID 7177275
(5S)-4-amino-3-(2-hydroxyethyl)-8,8-dimethyl-5-phenyl-7,9-dihydro-5H-chromeno[2,3-d]pyrimidin-3-ium-6-one (PubChem CID 7177275) has the molecular formula C21H24N3O3+ and a molecular weight of 366.44 g/mol. Its IUPAC name is (5S)-4-amino-3-(2-hydroxyethyl)-8,8-dimethyl-5-phenyl-7,9-dihydro-5H-chromeno[2,3-d]pyrimidin-3-ium-6-one.
| Compound Name | (5S)-4-amino-3-(2-hydroxyethyl)-8,8-dimethyl-5-phenyl-7,9-dihydro-5H-chromeno[2,3-d]pyrimidin-3-ium-6-one |
|---|---|
| PubChem CID | 7177275 |
| Molecular Formula | C21H24N3O3+ |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | (5S)-4-amino-3-(2-hydroxyethyl)-8,8-dimethyl-5-phenyl-7,9-dihydro-5H-chromeno[2,3-d]pyrimidin-3-ium-6-one |
| SMILES | CC1(C)CC(=O)C2=C(C1)Oc1nc[n+](CCO)c(N)c1[C@@H]2c1ccccc1 |
| InChI | InChI=1S/C21H23N3O3/c1-21(2)10-14(26)17-15(11-21)27-20-18(16(17)13-6-4-3-5-7-13)19(22)24(8-9-25)12-23-20/h3-7,12,16,22,25H,8-11H2,1-2H3/p+1/t16-/m1/s1 |
| InChIKey | UGOJFJSYMZOUSB-MRXNPFEDSA-O |
| XLogP | 2.11 |
| TPSA | 89.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|