C30H29N5O4 — CID 6373788
13-[[(Z)-1-(4-methoxyphenyl)ethylideneamino]oxymethyl]-5,5-dimethyl-9-phenyl-2-oxa-12,14,15,17-tetrazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(10),3(8),11,13,16-pentaen-7-one (PubChem CID 6373788) has the molecular formula C30H29N5O4 and a molecular weight of 523.59 g/mol. Its IUPAC name is 13-[[(Z)-1-(4-methoxyphenyl)ethylideneamino]oxymethyl]-5,5-dimethyl-9-phenyl-2-oxa-12,14,15,17-tetrazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(10),3(8),11,13,16-pentaen-7-one.
| Compound Name | 13-[[(Z)-1-(4-methoxyphenyl)ethylideneamino]oxymethyl]-5,5-dimethyl-9-phenyl-2-oxa-12,14,15,17-tetrazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(10),3(8),11,13,16-pentaen-7-one |
|---|---|
| PubChem CID | 6373788 |
| Molecular Formula | C30H29N5O4 |
| Molecular Weight | 523.59 g/mol |
| Exact Mass | 523.22 |
| IUPAC Name | 13-[[(Z)-1-(4-methoxyphenyl)ethylideneamino]oxymethyl]-5,5-dimethyl-9-phenyl-2-oxa-12,14,15,17-tetrazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(10),3(8),11,13,16-pentaen-7-one |
| SMILES | COc1ccc(/C(C)=N\OCc2nc3c4c(ncn3n2)OC2=C(C(=O)CC(C)(C)C2)C4c2ccccc2)cc1 |
| InChI | InChI=1S/C30H29N5O4/c1-18(19-10-12-21(37-4)13-11-19)34-38-16-24-32-28-27-25(20-8-6-5-7-9-20)26-22(36)14-30(2,3)15-23(26)39-29(27)31-17-35(28)33-24/h5-13,17,25H,14-16H2,1-4H3/b34-18- |
| InChIKey | VLNVNGQHTGREGZ-HQDYHJHZSA-N |
| XLogP | 5.24 |
| TPSA | 100.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.59 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|