C29H29N5O5S — CID 44664688
9-(3,4-dimethoxyphenyl)-5,5-dimethyl-13-[[(E)-1-thiophen-2-ylethylideneamino]oxymethyl]-2-oxa-12,14,15,17-tetrazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(10),3(8),11,13,16-pentaen-7-one (PubChem CID 44664688) has the molecular formula C29H29N5O5S and a molecular weight of 559.65 g/mol. Its IUPAC name is 9-(3,4-dimethoxyphenyl)-5,5-dimethyl-13-[[(E)-1-thiophen-2-ylethylideneamino]oxymethyl]-2-oxa-12,14,15,17-tetrazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(10),3(8),11,13,16-pentaen-7-one.
| Compound Name | 9-(3,4-dimethoxyphenyl)-5,5-dimethyl-13-[[(E)-1-thiophen-2-ylethylideneamino]oxymethyl]-2-oxa-12,14,15,17-tetrazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(10),3(8),11,13,16-pentaen-7-one |
|---|---|
| PubChem CID | 44664688 |
| Molecular Formula | C29H29N5O5S |
| Molecular Weight | 559.65 g/mol |
| Exact Mass | 559.19 |
| IUPAC Name | 9-(3,4-dimethoxyphenyl)-5,5-dimethyl-13-[[(E)-1-thiophen-2-ylethylideneamino]oxymethyl]-2-oxa-12,14,15,17-tetrazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(10),3(8),11,13,16-pentaen-7-one |
| SMILES | COc1ccc(C2C3=C(CC(C)(C)CC3=O)Oc3ncn4nc(CO/N=C(\C)c5cccs5)nc4c32)cc1OC |
| InChI | InChI=1S/C29H29N5O5S/c1-16(22-7-6-10-40-22)33-38-14-23-31-27-26-24(17-8-9-19(36-4)20(11-17)37-5)25-18(35)12-29(2,3)13-21(25)39-28(26)30-15-34(27)32-23/h6-11,15,24H,12-14H2,1-5H3/b33-16+ |
| InChIKey | MDLQQAFQBRDZBI-MHDJOFBISA-N |
| XLogP | 5.31 |
| TPSA | 109.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.65 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|