C40H46O6 — CID 12996042
3,3,6,6-tetramethyl-9-[4-(3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-xanthen-9-yl)phenyl]-4,5,7,9-tetrahydro-2H-xanthene-1,8-dione (PubChem CID 12996042) has the molecular formula C40H46O6 and a molecular weight of 622.80 g/mol. Its IUPAC name is 3,3,6,6-tetramethyl-9-[4-(3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-xanthen-9-yl)phenyl]-4,5,7,9-tetrahydro-2H-xanthene-1,8-dione.
| Compound Name | 3,3,6,6-tetramethyl-9-[4-(3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-xanthen-9-yl)phenyl]-4,5,7,9-tetrahydro-2H-xanthene-1,8-dione |
|---|---|
| PubChem CID | 12996042 |
| Molecular Formula | C40H46O6 |
| Molecular Weight | 622.80 g/mol |
| Exact Mass | 622.33 |
| IUPAC Name | 3,3,6,6-tetramethyl-9-[4-(3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-xanthen-9-yl)phenyl]-4,5,7,9-tetrahydro-2H-xanthene-1,8-dione |
| SMILES | CC1(C)CC(=O)C2=C(C1)OC1=C(C(=O)CC(C)(C)C1)C2c1ccc(C2C3=C(CC(C)(C)CC3=O)OC3=C2C(=O)CC(C)(C)C3)cc1 |
| InChI | InChI=1S/C40H46O6/c1-37(2)13-23(41)33-27(17-37)45-28-18-38(3,4)14-24(42)34(28)31(33)21-9-11-22(12-10-21)32-35-25(43)15-39(5,6)19-29(35)46-30-20-40(7,8)16-26(44)36(30)32/h9-12,31-32H,13-20H2,1-8H3 |
| InChIKey | NTIMWNNSRNEIQC-UHFFFAOYSA-N |
| XLogP | 8.49 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.80 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |