C26H31NO5 — CID 1072894
[4-(3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-xanthen-9-yl)phenyl] N,N-dimethylcarbamate (PubChem CID 1072894) has the molecular formula C26H31NO5 and a molecular weight of 437.54 g/mol. Its IUPAC name is [4-(3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-xanthen-9-yl)phenyl] N,N-dimethylcarbamate.
| Compound Name | [4-(3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-xanthen-9-yl)phenyl] N,N-dimethylcarbamate |
|---|---|
| PubChem CID | 1072894 |
| Molecular Formula | C26H31NO5 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.22 |
| IUPAC Name | [4-(3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-xanthen-9-yl)phenyl] N,N-dimethylcarbamate |
| SMILES | CN(C)C(=O)Oc1ccc(C2C3=C(CC(C)(C)CC3=O)OC3=C2C(=O)CC(C)(C)C3)cc1 |
| InChI | InChI=1S/C26H31NO5/c1-25(2)11-17(28)22-19(13-25)32-20-14-26(3,4)12-18(29)23(20)21(22)15-7-9-16(10-8-15)31-24(30)27(5)6/h7-10,21H,11-14H2,1-6H3 |
| InChIKey | RBCPANXRVAUJOK-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |