C30H38O9 — CID 123297203
3,3,6,6-tetramethyl-9-[4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxepan-2-yl]oxyphenyl]-4,5,7,9-tetrahydro-2H-xanthene-1,8-dione (PubChem CID 123297203) has the molecular formula C30H38O9 and a molecular weight of 542.63 g/mol. Its IUPAC name is 3,3,6,6-tetramethyl-9-[4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxepan-2-yl]oxyphenyl]-4,5,7,9-tetrahydro-2H-xanthene-1,8-dione.
| Compound Name | 3,3,6,6-tetramethyl-9-[4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxepan-2-yl]oxyphenyl]-4,5,7,9-tetrahydro-2H-xanthene-1,8-dione |
|---|---|
| PubChem CID | 123297203 |
| Molecular Formula | C30H38O9 |
| Molecular Weight | 542.63 g/mol |
| Exact Mass | 542.25 |
| IUPAC Name | 3,3,6,6-tetramethyl-9-[4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxepan-2-yl]oxyphenyl]-4,5,7,9-tetrahydro-2H-xanthene-1,8-dione |
| SMILES | CC1(C)CC(=O)C2=C(C1)OC1=C(C(=O)CC(C)(C)C1)C2c1ccc(OC2OCC(CO)C(O)C(O)C2O)cc1 |
| InChI | InChI=1S/C30H38O9/c1-29(2)9-18(32)23-20(11-29)39-21-12-30(3,4)10-19(33)24(21)22(23)15-5-7-17(8-6-15)38-28-27(36)26(35)25(34)16(13-31)14-37-28/h5-8,16,22,25-28,31,34-36H,9-14H2,1-4H3 |
| InChIKey | TVHASZYBDMEYNZ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 142.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.63 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |