C33H37NO5 — CID 126260990
N-(2,5-dimethylphenyl)-2-[4-(3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-xanthen-9-yl)phenoxy]acetamide (PubChem CID 126260990) has the molecular formula C33H37NO5 and a molecular weight of 527.66 g/mol. Its IUPAC name is N-(2,5-dimethylphenyl)-2-[4-(3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-xanthen-9-yl)phenoxy]acetamide.
| Compound Name | N-(2,5-dimethylphenyl)-2-[4-(3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-xanthen-9-yl)phenoxy]acetamide |
|---|---|
| PubChem CID | 126260990 |
| Molecular Formula | C33H37NO5 |
| Molecular Weight | 527.66 g/mol |
| Exact Mass | 527.27 |
| IUPAC Name | N-(2,5-dimethylphenyl)-2-[4-(3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-xanthen-9-yl)phenoxy]acetamide |
| SMILES | Cc1ccc(C)c(NC(=O)COc2ccc(C3C4=C(CC(C)(C)CC4=O)OC4=C3C(=O)CC(C)(C)C4)cc2)c1 |
| InChI | InChI=1S/C33H37NO5/c1-19-7-8-20(2)23(13-19)34-28(37)18-38-22-11-9-21(10-12-22)29-30-24(35)14-32(3,4)16-26(30)39-27-17-33(5,6)15-25(36)31(27)29/h7-13,29H,14-18H2,1-6H3,(H,34,37) |
| InChIKey | FURYDTVSZPMHJQ-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.66 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |