C32H36N2O4 — CID 126270065
N-(3-methylphenyl)-2-[4-(3,3,6,6-tetramethyl-1,8-dioxo-2,4,5,7,9,10-hexahydroacridin-9-yl)phenoxy]acetamide (PubChem CID 126270065) has the molecular formula C32H36N2O4 and a molecular weight of 512.65 g/mol. Its IUPAC name is N-(3-methylphenyl)-2-[4-(3,3,6,6-tetramethyl-1,8-dioxo-2,4,5,7,9,10-hexahydroacridin-9-yl)phenoxy]acetamide.
| Compound Name | N-(3-methylphenyl)-2-[4-(3,3,6,6-tetramethyl-1,8-dioxo-2,4,5,7,9,10-hexahydroacridin-9-yl)phenoxy]acetamide |
|---|---|
| PubChem CID | 126270065 |
| Molecular Formula | C32H36N2O4 |
| Molecular Weight | 512.65 g/mol |
| Exact Mass | 512.27 |
| IUPAC Name | N-(3-methylphenyl)-2-[4-(3,3,6,6-tetramethyl-1,8-dioxo-2,4,5,7,9,10-hexahydroacridin-9-yl)phenoxy]acetamide |
| SMILES | Cc1cccc(NC(=O)COc2ccc(C3C4=C(CC(C)(C)CC4=O)NC4=C3C(=O)CC(C)(C)C4)cc2)c1 |
| InChI | InChI=1S/C32H36N2O4/c1-19-7-6-8-21(13-19)33-27(37)18-38-22-11-9-20(10-12-22)28-29-23(14-31(2,3)16-25(29)35)34-24-15-32(4,5)17-26(36)30(24)28/h6-13,28,34H,14-18H2,1-5H3,(H,33,37) |
| InChIKey | JJFKRIWFSJKUQT-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.65 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |