C33H37FN2O5 — CID 126369111
2-[2-ethoxy-4-(3,3,6,6-tetramethyl-1,8-dioxo-2,4,5,7,9,10-hexahydroacridin-9-yl)phenoxy]-N-(4-fluorophenyl)acetamide (PubChem CID 126369111) has the molecular formula C33H37FN2O5 and a molecular weight of 560.67 g/mol. Its IUPAC name is 2-[2-ethoxy-4-(3,3,6,6-tetramethyl-1,8-dioxo-2,4,5,7,9,10-hexahydroacridin-9-yl)phenoxy]-N-(4-fluorophenyl)acetamide.
| Compound Name | 2-[2-ethoxy-4-(3,3,6,6-tetramethyl-1,8-dioxo-2,4,5,7,9,10-hexahydroacridin-9-yl)phenoxy]-N-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 126369111 |
| Molecular Formula | C33H37FN2O5 |
| Molecular Weight | 560.67 g/mol |
| Exact Mass | 560.27 |
| IUPAC Name | 2-[2-ethoxy-4-(3,3,6,6-tetramethyl-1,8-dioxo-2,4,5,7,9,10-hexahydroacridin-9-yl)phenoxy]-N-(4-fluorophenyl)acetamide |
| SMILES | CCOc1cc(C2C3=C(CC(C)(C)CC3=O)NC3=C2C(=O)CC(C)(C)C3)ccc1OCC(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C33H37FN2O5/c1-6-40-27-13-19(7-12-26(27)41-18-28(39)35-21-10-8-20(34)9-11-21)29-30-22(14-32(2,3)16-24(30)37)36-23-15-33(4,5)17-25(38)31(23)29/h7-13,29,36H,6,14-18H2,1-5H3,(H,35,39) |
| InChIKey | PASIYZNSVIRCMY-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.67 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |