C33H36ClNO6 — CID 126226416
N-(4-chlorophenyl)-2-[2-ethoxy-4-(3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-xanthen-9-yl)phenoxy]acetamide (PubChem CID 126226416) has the molecular formula C33H36ClNO6 and a molecular weight of 578.11 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-[2-ethoxy-4-(3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-xanthen-9-yl)phenoxy]acetamide.
| Compound Name | N-(4-chlorophenyl)-2-[2-ethoxy-4-(3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-xanthen-9-yl)phenoxy]acetamide |
|---|---|
| PubChem CID | 126226416 |
| Molecular Formula | C33H36ClNO6 |
| Molecular Weight | 578.11 g/mol |
| Exact Mass | 577.22 |
| IUPAC Name | N-(4-chlorophenyl)-2-[2-ethoxy-4-(3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-xanthen-9-yl)phenoxy]acetamide |
| SMILES | CCOc1cc(C2C3=C(CC(C)(C)CC3=O)OC3=C2C(=O)CC(C)(C)C3)ccc1OCC(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C33H36ClNO6/c1-6-39-25-13-19(7-12-24(25)40-18-28(38)35-21-10-8-20(34)9-11-21)29-30-22(36)14-32(2,3)16-26(30)41-27-17-33(4,5)15-23(37)31(27)29/h7-13,29H,6,14-18H2,1-5H3,(H,35,38) |
| InChIKey | ZLTIIMGHPPYRKY-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.11 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |