C34H38INO6 — CID 126228686
2-[2-ethoxy-6-iodo-4-(3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-xanthen-9-yl)phenoxy]-N-(4-methylphenyl)acetamide (PubChem CID 126228686) has the molecular formula C34H38INO6 and a molecular weight of 683.58 g/mol. Its IUPAC name is 2-[2-ethoxy-6-iodo-4-(3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-xanthen-9-yl)phenoxy]-N-(4-methylphenyl)acetamide.
| Compound Name | 2-[2-ethoxy-6-iodo-4-(3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-xanthen-9-yl)phenoxy]-N-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 126228686 |
| Molecular Formula | C34H38INO6 |
| Molecular Weight | 683.58 g/mol |
| Exact Mass | 683.17 |
| IUPAC Name | 2-[2-ethoxy-6-iodo-4-(3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-xanthen-9-yl)phenoxy]-N-(4-methylphenyl)acetamide |
| SMILES | CCOc1cc(C2C3=C(CC(C)(C)CC3=O)OC3=C2C(=O)CC(C)(C)C3)cc(I)c1OCC(=O)Nc1ccc(C)cc1 |
| InChI | InChI=1S/C34H38INO6/c1-7-40-25-13-20(12-22(35)32(25)41-18-28(39)36-21-10-8-19(2)9-11-21)29-30-23(37)14-33(3,4)16-26(30)42-27-17-34(5,6)15-24(38)31(27)29/h8-13,29H,7,14-18H2,1-6H3,(H,36,39) |
| InChIKey | DFYJJLNKHWYNST-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.58 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|