C36H43IN2O5 — CID 126260259
N-(2,5-dimethylphenyl)-2-[2-ethoxy-6-iodo-4-(3,3,6,6,10-pentamethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl)phenoxy]acetamide (PubChem CID 126260259) has the molecular formula C36H43IN2O5 and a molecular weight of 710.65 g/mol. Its IUPAC name is N-(2,5-dimethylphenyl)-2-[2-ethoxy-6-iodo-4-(3,3,6,6,10-pentamethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl)phenoxy]acetamide.
| Compound Name | N-(2,5-dimethylphenyl)-2-[2-ethoxy-6-iodo-4-(3,3,6,6,10-pentamethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl)phenoxy]acetamide |
|---|---|
| PubChem CID | 126260259 |
| Molecular Formula | C36H43IN2O5 |
| Molecular Weight | 710.65 g/mol |
| Exact Mass | 710.22 |
| IUPAC Name | N-(2,5-dimethylphenyl)-2-[2-ethoxy-6-iodo-4-(3,3,6,6,10-pentamethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl)phenoxy]acetamide |
| SMILES | CCOc1cc(C2C3=C(CC(C)(C)CC3=O)N(C)C3=C2C(=O)CC(C)(C)C3)cc(I)c1OCC(=O)Nc1cc(C)ccc1C |
| InChI | InChI=1S/C36H43IN2O5/c1-9-43-29-14-22(13-23(37)34(29)44-19-30(42)38-24-12-20(2)10-11-21(24)3)31-32-25(15-35(4,5)17-27(32)40)39(8)26-16-36(6,7)18-28(41)33(26)31/h10-14,31H,9,15-19H2,1-8H3,(H,38,42) |
| InChIKey | HOQCXJGICYPFLV-UHFFFAOYSA-N |
| XLogP | 7.64 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.65 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|