C28H34INO6 — CID 126079602
2-[2-ethoxy-6-iodo-4-(3,3,6,6,10-pentamethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl)phenoxy]acetic acid (PubChem CID 126079602) has the molecular formula C28H34INO6 and a molecular weight of 607.49 g/mol. Its IUPAC name is 2-[2-ethoxy-6-iodo-4-(3,3,6,6,10-pentamethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl)phenoxy]acetic acid.
| Compound Name | 2-[2-ethoxy-6-iodo-4-(3,3,6,6,10-pentamethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl)phenoxy]acetic acid |
|---|---|
| PubChem CID | 126079602 |
| Molecular Formula | C28H34INO6 |
| Molecular Weight | 607.49 g/mol |
| Exact Mass | 607.14 |
| IUPAC Name | 2-[2-ethoxy-6-iodo-4-(3,3,6,6,10-pentamethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl)phenoxy]acetic acid |
| SMILES | CCOc1cc(C2C3=C(CC(C)(C)CC3=O)N(C)C3=C2C(=O)CC(C)(C)C3)cc(I)c1OCC(=O)O |
| InChI | InChI=1S/C28H34INO6/c1-7-35-21-9-15(8-16(29)26(21)36-14-22(33)34)23-24-17(10-27(2,3)12-19(24)31)30(6)18-11-28(4,5)13-20(32)25(18)23/h8-9,23H,7,10-14H2,1-6H3,(H,33,34) |
| InChIKey | GGDJTVVTIKDZHZ-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.49 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|