C35H41ClN2O5 — CID 126229963
2-[2-chloro-6-ethoxy-4-(3,3,6,6,10-pentamethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl)phenoxy]-N-(4-methylphenyl)acetamide (PubChem CID 126229963) has the molecular formula C35H41ClN2O5 and a molecular weight of 605.18 g/mol. Its IUPAC name is 2-[2-chloro-6-ethoxy-4-(3,3,6,6,10-pentamethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl)phenoxy]-N-(4-methylphenyl)acetamide.
| Compound Name | 2-[2-chloro-6-ethoxy-4-(3,3,6,6,10-pentamethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl)phenoxy]-N-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 126229963 |
| Molecular Formula | C35H41ClN2O5 |
| Molecular Weight | 605.18 g/mol |
| Exact Mass | 604.27 |
| IUPAC Name | 2-[2-chloro-6-ethoxy-4-(3,3,6,6,10-pentamethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl)phenoxy]-N-(4-methylphenyl)acetamide |
| SMILES | CCOc1cc(C2C3=C(CC(C)(C)CC3=O)N(C)C3=C2C(=O)CC(C)(C)C3)cc(Cl)c1OCC(=O)Nc1ccc(C)cc1 |
| InChI | InChI=1S/C35H41ClN2O5/c1-8-42-28-14-21(13-23(36)33(28)43-19-29(41)37-22-11-9-20(2)10-12-22)30-31-24(15-34(3,4)17-26(31)39)38(7)25-16-35(5,6)18-27(40)32(25)30/h9-14,30H,8,15-19H2,1-7H3,(H,37,41) |
| InChIKey | HJKJKIUOROTCSM-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.18 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |