C30H38INO6 — CID 126082349
3-[9-(3-iodo-5-methoxy-4-propoxyphenyl)-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-10-yl]propanoic acid (PubChem CID 126082349) has the molecular formula C30H38INO6 and a molecular weight of 635.54 g/mol. Its IUPAC name is 3-[9-(3-iodo-5-methoxy-4-propoxyphenyl)-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-10-yl]propanoic acid.
| Compound Name | 3-[9-(3-iodo-5-methoxy-4-propoxyphenyl)-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-10-yl]propanoic acid |
|---|---|
| PubChem CID | 126082349 |
| Molecular Formula | C30H38INO6 |
| Molecular Weight | 635.54 g/mol |
| Exact Mass | 635.17 |
| IUPAC Name | 3-[9-(3-iodo-5-methoxy-4-propoxyphenyl)-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-10-yl]propanoic acid |
| SMILES | CCCOc1c(I)cc(C2C3=C(CC(C)(C)CC3=O)N(CCC(=O)O)C3=C2C(=O)CC(C)(C)C3)cc1OC |
| InChI | InChI=1S/C30H38INO6/c1-7-10-38-28-18(31)11-17(12-23(28)37-6)25-26-19(13-29(2,3)15-21(26)33)32(9-8-24(35)36)20-14-30(4,5)16-22(34)27(20)25/h11-12,25H,7-10,13-16H2,1-6H3,(H,35,36) |
| InChIKey | ZXVMALCZEXAULC-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.54 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|